C22H26O2 — CID 10639592
(1S,4R,5S,6S)-5,6-dimethyl-1,4-bis(4-methylphenyl)-2,3-dioxabicyclo[2.2.2]octane (PubChem CID 10639592) has the molecular formula C22H26O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is (1S,4R,5S,6S)-5,6-dimethyl-1,4-bis(4-methylphenyl)-2,3-dioxabicyclo[2.2.2]octane.
| Compound Name | (1S,4R,5S,6S)-5,6-dimethyl-1,4-bis(4-methylphenyl)-2,3-dioxabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 10639592 |
| Molecular Formula | C22H26O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | (1S,4R,5S,6S)-5,6-dimethyl-1,4-bis(4-methylphenyl)-2,3-dioxabicyclo[2.2.2]octane |
| SMILES | Cc1ccc([C@]23CC[C@](c4ccc(C)cc4)(OO2)[C@@H](C)[C@@H]3C)cc1 |
| InChI | InChI=1S/C22H26O2/c1-15-5-9-19(10-6-15)21-13-14-22(24-23-21,18(4)17(21)3)20-11-7-16(2)8-12-20/h5-12,17-18H,13-14H2,1-4H3/t17-,18-,21-,22+/m0/s1 |
| InChIKey | ICPKSWUVCMTEGF-YHDSQAASSA-N |
| XLogP | 5.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|