C21H24O — CID 101158468
(1S,5R)-1,5-bis(4-methylphenyl)-8-oxabicyclo[3.2.1]octane (PubChem CID 101158468) has the molecular formula C21H24O and a molecular weight of 292.42 g/mol. Its IUPAC name is (1S,5R)-1,5-bis(4-methylphenyl)-8-oxabicyclo[3.2.1]octane.
| Compound Name | (1S,5R)-1,5-bis(4-methylphenyl)-8-oxabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 101158468 |
| Molecular Formula | C21H24O |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (1S,5R)-1,5-bis(4-methylphenyl)-8-oxabicyclo[3.2.1]octane |
| SMILES | Cc1ccc([C@@]23CCC[C@@](c4ccc(C)cc4)(CC2)O3)cc1 |
| InChI | InChI=1S/C21H24O/c1-16-4-8-18(9-5-16)20-12-3-13-21(22-20,15-14-20)19-10-6-17(2)7-11-19/h4-11H,3,12-15H2,1-2H3/t20-,21+ |
| InChIKey | SQGLYGPZCOGLDW-OYRHEFFESA-N |
| XLogP | 5.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |