C20H36O3Si — CID 174816258
toluene;1,1,2-triethoxy-2-ethylsilinane (PubChem CID 174816258) has the molecular formula C20H36O3Si and a molecular weight of 352.59 g/mol. Its IUPAC name is toluene;1,1,2-triethoxy-2-ethylsilinane.
| Compound Name | toluene;1,1,2-triethoxy-2-ethylsilinane |
|---|---|
| PubChem CID | 174816258 |
| Molecular Formula | C20H36O3Si |
| Molecular Weight | 352.59 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | toluene;1,1,2-triethoxy-2-ethylsilinane |
| SMILES | CCOC1(CC)CCCC[Si]1(OCC)OCC.Cc1ccccc1 |
| InChI | InChI=1S/C13H28O3Si.C7H8/c1-5-13(14-6-2)11-9-10-12-17(13,15-7-3)16-8-4;1-7-5-3-2-4-6-7/h5-12H2,1-4H3;2-6H,1H3 |
| InChIKey | AUXBPRRWFYSNOI-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.59 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|