C16H34O5Si — CID 174783066
propanoic acid;1,1,2-triethoxy-2-ethylsilinane (PubChem CID 174783066) has the molecular formula C16H34O5Si and a molecular weight of 334.53 g/mol. Its IUPAC name is propanoic acid;1,1,2-triethoxy-2-ethylsilinane.
| Compound Name | propanoic acid;1,1,2-triethoxy-2-ethylsilinane |
|---|---|
| PubChem CID | 174783066 |
| Molecular Formula | C16H34O5Si |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | propanoic acid;1,1,2-triethoxy-2-ethylsilinane |
| SMILES | CCC(=O)O.CCOC1(CC)CCCC[Si]1(OCC)OCC |
| InChI | InChI=1S/C13H28O3Si.C3H6O2/c1-5-13(14-6-2)11-9-10-12-17(13,15-7-3)16-8-4;1-2-3(4)5/h5-12H2,1-4H3;2H2,1H3,(H,4,5) |
| InChIKey | FTFLDOFMNSTXDW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|