C13H28O4Si — CID 174248265
1,1,2,2-tetraethoxysilinane (PubChem CID 174248265) has the molecular formula C13H28O4Si and a molecular weight of 276.45 g/mol. Its IUPAC name is 1,1,2,2-tetraethoxysilinane.
| Compound Name | 1,1,2,2-tetraethoxysilinane |
|---|---|
| PubChem CID | 174248265 |
| Molecular Formula | C13H28O4Si |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 1,1,2,2-tetraethoxysilinane |
| SMILES | CCOC1(OCC)CCCC[Si]1(OCC)OCC |
| InChI | InChI=1S/C13H28O4Si/c1-5-14-13(15-6-2)11-9-10-12-18(13,16-7-3)17-8-4/h5-12H2,1-4H3 |
| InChIKey | JYCXMNMWYQHEPE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|