C19H38O4Si — CID 174976602
2-ethyl-3-[4-(1,1,2-triethoxysilinan-2-yl)butyl]oxirane (PubChem CID 174976602) has the molecular formula C19H38O4Si and a molecular weight of 358.60 g/mol. Its IUPAC name is 2-ethyl-3-[4-(1,1,2-triethoxysilinan-2-yl)butyl]oxirane.
| Compound Name | 2-ethyl-3-[4-(1,1,2-triethoxysilinan-2-yl)butyl]oxirane |
|---|---|
| PubChem CID | 174976602 |
| Molecular Formula | C19H38O4Si |
| Molecular Weight | 358.60 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 2-ethyl-3-[4-(1,1,2-triethoxysilinan-2-yl)butyl]oxirane |
| SMILES | CCOC1(CCCCC2OC2CC)CCCC[Si]1(OCC)OCC |
| InChI | InChI=1S/C19H38O4Si/c1-5-17-18(23-17)13-9-10-14-19(20-6-2)15-11-12-16-24(19,21-7-3)22-8-4/h17-18H,5-16H2,1-4H3 |
| InChIKey | LCUIXQMWIFJPDM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.60 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|