C16H36N2O3Si — CID 174522138
5-(1,1,2-triethoxysilinan-2-yl)pentane-1,3-diamine (PubChem CID 174522138) has the molecular formula C16H36N2O3Si and a molecular weight of 332.56 g/mol. Its IUPAC name is 5-(1,1,2-triethoxysilinan-2-yl)pentane-1,3-diamine.
| Compound Name | 5-(1,1,2-triethoxysilinan-2-yl)pentane-1,3-diamine |
|---|---|
| PubChem CID | 174522138 |
| Molecular Formula | C16H36N2O3Si |
| Molecular Weight | 332.56 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | 5-(1,1,2-triethoxysilinan-2-yl)pentane-1,3-diamine |
| SMILES | CCOC1(CCC(N)CCN)CCCC[Si]1(OCC)OCC |
| InChI | InChI=1S/C16H36N2O3Si/c1-4-19-16(12-9-15(18)10-13-17)11-7-8-14-22(16,20-5-2)21-6-3/h15H,4-14,17-18H2,1-3H3 |
| InChIKey | FFEOTZNRYSIHHA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.56 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|