C17H35NO4Si — CID 174864706
N-methylprop-2-enamide;1,1,2-triethoxy-2-ethylsilinane (PubChem CID 174864706) has the molecular formula C17H35NO4Si and a molecular weight of 345.56 g/mol. Its IUPAC name is N-methylprop-2-enamide;1,1,2-triethoxy-2-ethylsilinane.
| Compound Name | N-methylprop-2-enamide;1,1,2-triethoxy-2-ethylsilinane |
|---|---|
| PubChem CID | 174864706 |
| Molecular Formula | C17H35NO4Si |
| Molecular Weight | 345.56 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | N-methylprop-2-enamide;1,1,2-triethoxy-2-ethylsilinane |
| SMILES | C=CC(=O)NC.CCOC1(CC)CCCC[Si]1(OCC)OCC |
| InChI | InChI=1S/C13H28O3Si.C4H7NO/c1-5-13(14-6-2)11-9-10-12-17(13,15-7-3)16-8-4;1-3-4(6)5-2/h5-12H2,1-4H3;3H,1H2,2H3,(H,5,6) |
| InChIKey | MAHAPJKIYAAVCN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.56 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|