C22H45NO6Si — CID 174964240
[2-hydroxy-3-(propylamino)propyl] prop-2-enoate;1,1,2-triethoxy-2-ethylsilinane (PubChem CID 174964240) has the molecular formula C22H45NO6Si and a molecular weight of 447.69 g/mol. Its IUPAC name is [2-hydroxy-3-(propylamino)propyl] prop-2-enoate;1,1,2-triethoxy-2-ethylsilinane.
| Compound Name | [2-hydroxy-3-(propylamino)propyl] prop-2-enoate;1,1,2-triethoxy-2-ethylsilinane |
|---|---|
| PubChem CID | 174964240 |
| Molecular Formula | C22H45NO6Si |
| Molecular Weight | 447.69 g/mol |
| Exact Mass | 447.30 |
| IUPAC Name | [2-hydroxy-3-(propylamino)propyl] prop-2-enoate;1,1,2-triethoxy-2-ethylsilinane |
| SMILES | C=CC(=O)OCC(O)CNCCC.CCOC1(CC)CCCC[Si]1(OCC)OCC |
| InChI | InChI=1S/C13H28O3Si.C9H17NO3/c1-5-13(14-6-2)11-9-10-12-17(13,15-7-3)16-8-4;1-3-5-10-6-8(11)7-13-9(12)4-2/h5-12H2,1-4H3;4,8,10-11H,2-3,5-7H2,1H3 |
| InChIKey | ZFIZOZHNYDDELA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.69 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|