C27H38O3Si — CID 174932363
phenanthrene;1,1,2-triethoxy-2-ethylsilinane (PubChem CID 174932363) has the molecular formula C27H38O3Si and a molecular weight of 438.68 g/mol. Its IUPAC name is phenanthrene;1,1,2-triethoxy-2-ethylsilinane.
| Compound Name | phenanthrene;1,1,2-triethoxy-2-ethylsilinane |
|---|---|
| PubChem CID | 174932363 |
| Molecular Formula | C27H38O3Si |
| Molecular Weight | 438.68 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | phenanthrene;1,1,2-triethoxy-2-ethylsilinane |
| SMILES | CCOC1(CC)CCCC[Si]1(OCC)OCC.c1ccc2c(c1)ccc1ccccc12 |
| InChI | InChI=1S/C14H10.C13H28O3Si/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;1-5-13(14-6-2)11-9-10-12-17(13,15-7-3)16-8-4/h1-10H;5-12H2,1-4H3 |
| InChIKey | AEGRZPCWSHOORT-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.68 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|