C19H33ClO4Si — CID 174609072
phenyl hypochlorite;1,1,2-triethoxy-2-ethylsilinane (PubChem CID 174609072) has the molecular formula C19H33ClO4Si and a molecular weight of 389.01 g/mol. Its IUPAC name is phenyl hypochlorite;1,1,2-triethoxy-2-ethylsilinane.
| Compound Name | phenyl hypochlorite;1,1,2-triethoxy-2-ethylsilinane |
|---|---|
| PubChem CID | 174609072 |
| Molecular Formula | C19H33ClO4Si |
| Molecular Weight | 389.01 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | phenyl hypochlorite;1,1,2-triethoxy-2-ethylsilinane |
| SMILES | CCOC1(CC)CCCC[Si]1(OCC)OCC.ClOc1ccccc1 |
| InChI | InChI=1S/C13H28O3Si.C6H5ClO/c1-5-13(14-6-2)11-9-10-12-17(13,15-7-3)16-8-4;7-8-6-4-2-1-3-5-6/h5-12H2,1-4H3;1-5H |
| InChIKey | PMCDQCMSJMPTON-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.01 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|