C19H33ClO4Si — CID 174609070
4-chlorophenol;1,1,2-triethoxy-2-ethylsilinane (PubChem CID 174609070) has the molecular formula C19H33ClO4Si and a molecular weight of 389.01 g/mol. Its IUPAC name is 4-chlorophenol;1,1,2-triethoxy-2-ethylsilinane.
| Compound Name | 4-chlorophenol;1,1,2-triethoxy-2-ethylsilinane |
|---|---|
| PubChem CID | 174609070 |
| Molecular Formula | C19H33ClO4Si |
| Molecular Weight | 389.01 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 4-chlorophenol;1,1,2-triethoxy-2-ethylsilinane |
| SMILES | CCOC1(CC)CCCC[Si]1(OCC)OCC.Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H28O3Si.C6H5ClO/c1-5-13(14-6-2)11-9-10-12-17(13,15-7-3)16-8-4;7-5-1-3-6(8)4-2-5/h5-12H2,1-4H3;1-4,8H |
| InChIKey | GOCMGOIBUWTTPE-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.01 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|