C37H80N2O13Si3 — CID 175297530
[2-hydroxy-3-(4-triethoxysilylbutanoylamino)propyl] prop-2-enoate;4-triethoxysilylbutan-1-amine;1,1,2-trimethoxy-2-propylsilinane (PubChem CID 175297530) has the molecular formula C37H80N2O13Si3 and a molecular weight of 845.31 g/mol. Its IUPAC name is [2-hydroxy-3-(4-triethoxysilylbutanoylamino)propyl] prop-2-enoate;4-triethoxysilylbutan-1-amine;1,1,2-trimethoxy-2-propylsilinane.
| Compound Name | [2-hydroxy-3-(4-triethoxysilylbutanoylamino)propyl] prop-2-enoate;4-triethoxysilylbutan-1-amine;1,1,2-trimethoxy-2-propylsilinane |
|---|---|
| PubChem CID | 175297530 |
| Molecular Formula | C37H80N2O13Si3 |
| Molecular Weight | 845.31 g/mol |
| Exact Mass | 844.50 |
| IUPAC Name | [2-hydroxy-3-(4-triethoxysilylbutanoylamino)propyl] prop-2-enoate;4-triethoxysilylbutan-1-amine;1,1,2-trimethoxy-2-propylsilinane |
| SMILES | C=CC(=O)OCC(O)CNC(=O)CCC[Si](OCC)(OCC)OCC.CCCC1(OC)CCCC[Si]1(OC)OC.CCO[Si](CCCCN)(OCC)OCC |
| InChI | InChI=1S/C16H31NO7Si.C11H24O3Si.C10H25NO3Si/c1-5-16(20)21-13-14(18)12-17-15(19)10-9-11-25(22-6-2,23-7-3)24-8-4;1-5-8-11(12-2)9-6-7-10-15(11,13-3)14-4;1-4-12-15(13-5-2,14-6-3)10-8-7-9-11/h5,14,18H,1,6-13H2,2-4H3,(H,17,19);5-10H2,1-4H3;4-11H2,1-3H3 |
| InChIKey | BECVIKKOVDOWGL-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 184.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.31 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|