C13H29ClO3Si — CID 174406233
chloroethane;1,1,2-trimethoxy-2-propylsilinane (PubChem CID 174406233) has the molecular formula C13H29ClO3Si and a molecular weight of 296.91 g/mol. Its IUPAC name is chloroethane;1,1,2-trimethoxy-2-propylsilinane.
| Compound Name | chloroethane;1,1,2-trimethoxy-2-propylsilinane |
|---|---|
| PubChem CID | 174406233 |
| Molecular Formula | C13H29ClO3Si |
| Molecular Weight | 296.91 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | chloroethane;1,1,2-trimethoxy-2-propylsilinane |
| SMILES | CCCC1(OC)CCCC[Si]1(OC)OC.CCCl |
| InChI | InChI=1S/C11H24O3Si.C2H5Cl/c1-5-8-11(12-2)9-6-7-10-15(11,13-3)14-4;1-2-3/h5-10H2,1-4H3;2H2,1H3 |
| InChIKey | UOGFQQPEAXGWMK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.91 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|