C16H35NO3Si — CID 175279525
N-[3-(1,1,2-trimethoxysilinan-2-yl)propyl]pentan-1-amine (PubChem CID 175279525) has the molecular formula C16H35NO3Si and a molecular weight of 317.55 g/mol. Its IUPAC name is N-[3-(1,1,2-trimethoxysilinan-2-yl)propyl]pentan-1-amine.
| Compound Name | N-[3-(1,1,2-trimethoxysilinan-2-yl)propyl]pentan-1-amine |
|---|---|
| PubChem CID | 175279525 |
| Molecular Formula | C16H35NO3Si |
| Molecular Weight | 317.55 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | N-[3-(1,1,2-trimethoxysilinan-2-yl)propyl]pentan-1-amine |
| SMILES | CCCCCNCCCC1(OC)CCCC[Si]1(OC)OC |
| InChI | InChI=1S/C16H35NO3Si/c1-5-6-8-13-17-14-10-12-16(18-2)11-7-9-15-21(16,19-3)20-4/h17H,5-15H2,1-4H3 |
| InChIKey | IRCVMALCDLXXRV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.55 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|