C19H41NO3Si — CID 174392249
N-butyl-N-[3-(1,1,2-trimethoxysilinan-2-yl)propyl]butan-1-amine (PubChem CID 174392249) has the molecular formula C19H41NO3Si and a molecular weight of 359.63 g/mol. Its IUPAC name is N-butyl-N-[3-(1,1,2-trimethoxysilinan-2-yl)propyl]butan-1-amine.
| Compound Name | N-butyl-N-[3-(1,1,2-trimethoxysilinan-2-yl)propyl]butan-1-amine |
|---|---|
| PubChem CID | 174392249 |
| Molecular Formula | C19H41NO3Si |
| Molecular Weight | 359.63 g/mol |
| Exact Mass | 359.29 |
| IUPAC Name | N-butyl-N-[3-(1,1,2-trimethoxysilinan-2-yl)propyl]butan-1-amine |
| SMILES | CCCCN(CCCC)CCCC1(OC)CCCC[Si]1(OC)OC |
| InChI | InChI=1S/C19H41NO3Si/c1-6-8-15-20(16-9-7-2)17-12-14-19(21-3)13-10-11-18-24(19,22-4)23-5/h6-18H2,1-5H3 |
| InChIKey | HOOHEQWEARUAMB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.63 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|