C15H34O4Si — CID 174297956
ethoxyethane;1,1,2-trimethoxy-2-propylsilinane (PubChem CID 174297956) has the molecular formula C15H34O4Si and a molecular weight of 306.52 g/mol. Its IUPAC name is ethoxyethane;1,1,2-trimethoxy-2-propylsilinane.
| Compound Name | ethoxyethane;1,1,2-trimethoxy-2-propylsilinane |
|---|---|
| PubChem CID | 174297956 |
| Molecular Formula | C15H34O4Si |
| Molecular Weight | 306.52 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | ethoxyethane;1,1,2-trimethoxy-2-propylsilinane |
| SMILES | CCCC1(OC)CCCC[Si]1(OC)OC.CCOCC |
| InChI | InChI=1S/C11H24O3Si.C4H10O/c1-5-8-11(12-2)9-6-7-10-15(11,13-3)14-4;1-3-5-4-2/h5-10H2,1-4H3;3-4H2,1-2H3 |
| InChIKey | KVPPODOSLQFRLG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|