C15H31NO4Si — CID 174413955
but-2-enamide;1,1,2-trimethoxy-2-propylsilinane (PubChem CID 174413955) has the molecular formula C15H31NO4Si and a molecular weight of 317.50 g/mol. Its IUPAC name is but-2-enamide;1,1,2-trimethoxy-2-propylsilinane.
| Compound Name | but-2-enamide;1,1,2-trimethoxy-2-propylsilinane |
|---|---|
| PubChem CID | 174413955 |
| Molecular Formula | C15H31NO4Si |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | but-2-enamide;1,1,2-trimethoxy-2-propylsilinane |
| SMILES | CC=CC(N)=O.CCCC1(OC)CCCC[Si]1(OC)OC |
| InChI | InChI=1S/C11H24O3Si.C4H7NO/c1-5-8-11(12-2)9-6-7-10-15(11,13-3)14-4;1-2-3-4(5)6/h5-10H2,1-4H3;2-3H,1H3,(H2,5,6) |
| InChIKey | JIIJDBYYMKXFEV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|