About but-2-enamide;1,1,2-trimethoxy-2-propylsilinane
but-2-enamide;1,1,2-trimethoxy-2-propylsilinane (PubChem CID 174413955) has the molecular formula C15H31NO4Si
and a molecular weight of 317.50 g/mol. Its IUPAC name is but-2-enamide;1,1,2-trimethoxy-2-propylsilinane.
Molecular Properties
| Compound Name | but-2-enamide;1,1,2-trimethoxy-2-propylsilinane |
| PubChem CID | 174413955 |
| Molecular Formula | C15H31NO4Si |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | but-2-enamide;1,1,2-trimethoxy-2-propylsilinane |
| SMILES | CC=CC(N)=O.CCCC1(OC)CCCC[Si]1(OC)OC |
| InChI | InChI=1S/C11H24O3Si.C4H7NO/c1-5-8-11(12-2)9-6-7-10-15(11,13-3)14-4;1-2-3-4(5)6/h5-10H2,1-4H3;2-3H,1H3,(H2,5,6) |
| InChIKey | JIIJDBYYMKXFEV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze but-2-enamide;1,1,2-trimethoxy-2-propylsilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enamide;1,1,2-trimethoxy-2-propylsilinane?
The IUPAC name of but-2-enamide;1,1,2-trimethoxy-2-propylsilinane (CID 174413955) is but-2-enamide;1,1,2-trimethoxy-2-propylsilinane.
What is the SMILES notation for but-2-enamide;1,1,2-trimethoxy-2-propylsilinane?
The canonical SMILES for but-2-enamide;1,1,2-trimethoxy-2-propylsilinane is CC=CC(N)=O.CCCC1(OC)CCCC[Si]1(OC)OC.
What is the InChIKey of but-2-enamide;1,1,2-trimethoxy-2-propylsilinane?
The InChIKey is JIIJDBYYMKXFEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24O3Si.C4H7NO/c1-5-8-11(12-2)9-6-7-10-15(11,13-3)14-4;1-2-3-4(5)6/h5-10H2,1-4H3;2-3H,1H3,(H2,5,6).
What are the key properties of but-2-enamide;1,1,2-trimethoxy-2-propylsilinane?
but-2-enamide;1,1,2-trimethoxy-2-propylsilinane has a molecular weight of 317.50 g/mol, XLogP of 2.68, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enamide;1,1,2-trimethoxy-2-propylsilinane is sourced from PubChem (CID 174413955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).