C22H46O9Si2 — CID 175262529
tetraethyl silicate;3-(1,1,2-trimethoxysilinan-2-yl)propyl prop-2-enoate (PubChem CID 175262529) has the molecular formula C22H46O9Si2 and a molecular weight of 510.77 g/mol. Its IUPAC name is tetraethyl silicate;3-(1,1,2-trimethoxysilinan-2-yl)propyl prop-2-enoate.
| Compound Name | tetraethyl silicate;3-(1,1,2-trimethoxysilinan-2-yl)propyl prop-2-enoate |
|---|---|
| PubChem CID | 175262529 |
| Molecular Formula | C22H46O9Si2 |
| Molecular Weight | 510.77 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | tetraethyl silicate;3-(1,1,2-trimethoxysilinan-2-yl)propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCC1(OC)CCCC[Si]1(OC)OC.CCO[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C14H26O5Si.C8H20O4Si/c1-5-13(15)19-11-8-10-14(16-2)9-6-7-12-20(14,17-3)18-4;1-5-9-13(10-6-2,11-7-3)12-8-4/h5H,1,6-12H2,2-4H3;5-8H2,1-4H3 |
| InChIKey | QSUGWXAANZZDAN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.77 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|