C18H37NO2Si — CID 174873757
azane;4-(1,1,2-triethylsilinan-2-yl)butyl prop-2-enoate (PubChem CID 174873757) has the molecular formula C18H37NO2Si and a molecular weight of 327.59 g/mol. Its IUPAC name is azane;4-(1,1,2-triethylsilinan-2-yl)butyl prop-2-enoate.
| Compound Name | azane;4-(1,1,2-triethylsilinan-2-yl)butyl prop-2-enoate |
|---|---|
| PubChem CID | 174873757 |
| Molecular Formula | C18H37NO2Si |
| Molecular Weight | 327.59 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | azane;4-(1,1,2-triethylsilinan-2-yl)butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCC1(CC)CCCC[Si]1(CC)CC.N |
| InChI | InChI=1S/C18H34O2Si.H3N/c1-5-17(19)20-15-11-9-13-18(6-2)14-10-12-16-21(18,7-3)8-4;/h5H,1,6-16H2,2-4H3;1H3 |
| InChIKey | FCDCIDANHROJDM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 61.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.59 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|