C14H28N2O3Si — CID 174851969
1H-imidazole;1,1,2-trimethoxy-2-propylsilinane (PubChem CID 174851969) has the molecular formula C14H28N2O3Si and a molecular weight of 300.47 g/mol. Its IUPAC name is 1H-imidazole;1,1,2-trimethoxy-2-propylsilinane.
| Compound Name | 1H-imidazole;1,1,2-trimethoxy-2-propylsilinane |
|---|---|
| PubChem CID | 174851969 |
| Molecular Formula | C14H28N2O3Si |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 1H-imidazole;1,1,2-trimethoxy-2-propylsilinane |
| SMILES | CCCC1(OC)CCCC[Si]1(OC)OC.c1c[nH]cn1 |
| InChI | InChI=1S/C11H24O3Si.C3H4N2/c1-5-8-11(12-2)9-6-7-10-15(11,13-3)14-4;1-2-5-3-4-1/h5-10H2,1-4H3;1-3H,(H,4,5) |
| InChIKey | WMNWYOGCDWTRTQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 56.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|