C15H28O4Si — CID 174413287
2-methyl-6-(1,1,2-trimethoxysilinan-2-yl)hex-1-en-3-one (PubChem CID 174413287) has the molecular formula C15H28O4Si and a molecular weight of 300.47 g/mol. Its IUPAC name is 2-methyl-6-(1,1,2-trimethoxysilinan-2-yl)hex-1-en-3-one.
| Compound Name | 2-methyl-6-(1,1,2-trimethoxysilinan-2-yl)hex-1-en-3-one |
|---|---|
| PubChem CID | 174413287 |
| Molecular Formula | C15H28O4Si |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 2-methyl-6-(1,1,2-trimethoxysilinan-2-yl)hex-1-en-3-one |
| SMILES | C=C(C)C(=O)CCCC1(OC)CCCC[Si]1(OC)OC |
| InChI | InChI=1S/C15H28O4Si/c1-13(2)14(16)9-8-11-15(17-3)10-6-7-12-20(15,18-4)19-5/h1,6-12H2,2-5H3 |
| InChIKey | CNEXZBJDDVXWAZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|