C12H23NO3SSi — CID 174434144
2-(3-isothiocyanatopropyl)-1,1,2-trimethoxysilinane (PubChem CID 174434144) has the molecular formula C12H23NO3SSi and a molecular weight of 289.47 g/mol. Its IUPAC name is 2-(3-isothiocyanatopropyl)-1,1,2-trimethoxysilinane.
| Compound Name | 2-(3-isothiocyanatopropyl)-1,1,2-trimethoxysilinane |
|---|---|
| PubChem CID | 174434144 |
| Molecular Formula | C12H23NO3SSi |
| Molecular Weight | 289.47 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2-(3-isothiocyanatopropyl)-1,1,2-trimethoxysilinane |
| SMILES | COC1(CCCN=C=S)CCCC[Si]1(OC)OC |
| InChI | InChI=1S/C12H23NO3SSi/c1-14-12(8-6-9-13-11-17)7-4-5-10-18(12,15-2)16-3/h4-10H2,1-3H3 |
| InChIKey | MYHLZOJNHJMSHX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|