C17H29NO4Si — CID 174819805
2-[3-(1,1,2-trimethoxysilinan-2-yl)propoxy]aniline (PubChem CID 174819805) has the molecular formula C17H29NO4Si and a molecular weight of 339.51 g/mol. Its IUPAC name is 2-[3-(1,1,2-trimethoxysilinan-2-yl)propoxy]aniline.
| Compound Name | 2-[3-(1,1,2-trimethoxysilinan-2-yl)propoxy]aniline |
|---|---|
| PubChem CID | 174819805 |
| Molecular Formula | C17H29NO4Si |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 2-[3-(1,1,2-trimethoxysilinan-2-yl)propoxy]aniline |
| SMILES | COC1(CCCOc2ccccc2N)CCCC[Si]1(OC)OC |
| InChI | InChI=1S/C17H29NO4Si/c1-19-17(11-6-7-14-23(17,20-2)21-3)12-8-13-22-16-10-5-4-9-15(16)18/h4-5,9-10H,6-8,11-14,18H2,1-3H3 |
| InChIKey | WKWHRJNZNCEMIF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|