C11H25O6SSi- — CID 174790956
hydrogen sulfite;1,1,2-trimethoxy-2-propylsilinane (PubChem CID 174790956) has the molecular formula C11H25O6SSi- and a molecular weight of 313.47 g/mol. Its IUPAC name is hydrogen sulfite;1,1,2-trimethoxy-2-propylsilinane.
| Compound Name | hydrogen sulfite;1,1,2-trimethoxy-2-propylsilinane |
|---|---|
| PubChem CID | 174790956 |
| Molecular Formula | C11H25O6SSi- |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | hydrogen sulfite;1,1,2-trimethoxy-2-propylsilinane |
| SMILES | CCCC1(OC)CCCC[Si]1(OC)OC.O=S([O-])O |
| InChI | InChI=1S/C11H24O3Si.H2O3S/c1-5-8-11(12-2)9-6-7-10-15(11,13-3)14-4;1-4(2)3/h5-10H2,1-4H3;(H2,1,2,3)/p-1 |
| InChIKey | PRBPCLXKCSJXFK-UHFFFAOYSA-M |
| XLogP | 1.97 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|