C17H34O6Si — CID 174317269
2-(oxiran-2-ylmethoxymethyl)oxirane;1,1,2-trimethoxy-2-propylsilinane (PubChem CID 174317269) has the molecular formula C17H34O6Si and a molecular weight of 362.54 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethoxymethyl)oxirane;1,1,2-trimethoxy-2-propylsilinane.
| Compound Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;1,1,2-trimethoxy-2-propylsilinane |
|---|---|
| PubChem CID | 174317269 |
| Molecular Formula | C17H34O6Si |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;1,1,2-trimethoxy-2-propylsilinane |
| SMILES | C(OCC1CO1)C1CO1.CCCC1(OC)CCCC[Si]1(OC)OC |
| InChI | InChI=1S/C11H24O3Si.C6H10O3/c1-5-8-11(12-2)9-6-7-10-15(11,13-3)14-4;1(5-3-8-5)7-2-6-4-9-6/h5-10H2,1-4H3;5-6H,1-4H2 |
| InChIKey | NYHXAKZKTZXTFV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|