C17H34O5Si — CID 174249730
2-[4-(1,1,2-trimethoxysilinan-2-yl)hexoxymethyl]oxirane (PubChem CID 174249730) has the molecular formula C17H34O5Si and a molecular weight of 346.54 g/mol. Its IUPAC name is 2-[4-(1,1,2-trimethoxysilinan-2-yl)hexoxymethyl]oxirane.
| Compound Name | 2-[4-(1,1,2-trimethoxysilinan-2-yl)hexoxymethyl]oxirane |
|---|---|
| PubChem CID | 174249730 |
| Molecular Formula | C17H34O5Si |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | 2-[4-(1,1,2-trimethoxysilinan-2-yl)hexoxymethyl]oxirane |
| SMILES | CCC(CCCOCC1CO1)C1(OC)CCCC[Si]1(OC)OC |
| InChI | InChI=1S/C17H34O5Si/c1-5-15(9-8-11-21-13-16-14-22-16)17(18-2)10-6-7-12-23(17,19-3)20-4/h15-16H,5-14H2,1-4H3 |
| InChIKey | BEKMHWADTCEOPR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|