C12H27NO3Si — CID 174519087
2-methyl-3-(1,1,2-trimethoxysilinan-2-yl)propan-1-amine (PubChem CID 174519087) has the molecular formula C12H27NO3Si and a molecular weight of 261.44 g/mol. Its IUPAC name is 2-methyl-3-(1,1,2-trimethoxysilinan-2-yl)propan-1-amine.
| Compound Name | 2-methyl-3-(1,1,2-trimethoxysilinan-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 174519087 |
| Molecular Formula | C12H27NO3Si |
| Molecular Weight | 261.44 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 2-methyl-3-(1,1,2-trimethoxysilinan-2-yl)propan-1-amine |
| SMILES | COC1(CC(C)CN)CCCC[Si]1(OC)OC |
| InChI | InChI=1S/C12H27NO3Si/c1-11(10-13)9-12(14-2)7-5-6-8-17(12,15-3)16-4/h11H,5-10,13H2,1-4H3 |
| InChIKey | NKPZSCUDSHLKKC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|