C14H28O3Si — CID 174341764
2-cyclopropyl-1,1,2-triethoxysilinane (PubChem CID 174341764) has the molecular formula C14H28O3Si and a molecular weight of 272.46 g/mol. Its IUPAC name is 2-cyclopropyl-1,1,2-triethoxysilinane.
| Compound Name | 2-cyclopropyl-1,1,2-triethoxysilinane |
|---|---|
| PubChem CID | 174341764 |
| Molecular Formula | C14H28O3Si |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 2-cyclopropyl-1,1,2-triethoxysilinane |
| SMILES | CCOC1(C2CC2)CCCC[Si]1(OCC)OCC |
| InChI | InChI=1S/C14H28O3Si/c1-4-15-14(13-9-10-13)11-7-8-12-18(14,16-5-2)17-6-3/h13H,4-12H2,1-3H3 |
| InChIKey | SSAXWCKTVHBZCX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|