C12H26O3Si — CID 175280918
1,1,2-trimethoxy-4-methyl-2-propylsilinane (PubChem CID 175280918) has the molecular formula C12H26O3Si and a molecular weight of 246.42 g/mol. Its IUPAC name is 1,1,2-trimethoxy-4-methyl-2-propylsilinane.
| Compound Name | 1,1,2-trimethoxy-4-methyl-2-propylsilinane |
|---|---|
| PubChem CID | 175280918 |
| Molecular Formula | C12H26O3Si |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 1,1,2-trimethoxy-4-methyl-2-propylsilinane |
| SMILES | CCCC1(OC)CC(C)CC[Si]1(OC)OC |
| InChI | InChI=1S/C12H26O3Si/c1-6-8-12(13-3)10-11(2)7-9-16(12,14-4)15-5/h11H,6-10H2,1-5H3 |
| InChIKey | LITSUZGJKHUWAN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|