C21H34O3Si — CID 174931569
ethynylbenzene;1,2,2-triethoxy-1-ethylsilinane (PubChem CID 174931569) has the molecular formula C21H34O3Si and a molecular weight of 362.59 g/mol. Its IUPAC name is ethynylbenzene;1,2,2-triethoxy-1-ethylsilinane.
| Compound Name | ethynylbenzene;1,2,2-triethoxy-1-ethylsilinane |
|---|---|
| PubChem CID | 174931569 |
| Molecular Formula | C21H34O3Si |
| Molecular Weight | 362.59 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | ethynylbenzene;1,2,2-triethoxy-1-ethylsilinane |
| SMILES | C#Cc1ccccc1.CCOC1(OCC)CCCC[Si]1(CC)OCC |
| InChI | InChI=1S/C13H28O3Si.C8H6/c1-5-14-13(15-6-2)11-9-10-12-17(13,8-4)16-7-3;1-2-8-6-4-3-5-7-8/h5-12H2,1-4H3;1,3-7H |
| InChIKey | VYDVDTKLDZJJJB-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.59 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|