About ethylbenzene;1-ethyl-3-ethynylbenzene;propane
ethylbenzene;1-ethyl-3-ethynylbenzene;propane (PubChem CID 171552337) has the molecular formula C21H28
and a molecular weight of 280.45 g/mol. Its IUPAC name is ethylbenzene;1-ethyl-3-ethynylbenzene;propane.
Molecular Properties
| Compound Name | ethylbenzene;1-ethyl-3-ethynylbenzene;propane |
| PubChem CID | 171552337 |
| Molecular Formula | C21H28 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | ethylbenzene;1-ethyl-3-ethynylbenzene;propane |
| SMILES | C#Cc1cccc(CC)c1.CCC.CCc1ccccc1 |
| InChI | InChI=1S/C10H10.C8H10.C3H8/c1-3-9-6-5-7-10(4-2)8-9;1-2-8-6-4-3-5-7-8;1-3-2/h1,5-8H,4H2,2H3;3-7H,2H2,1H3;3H2,1-2H3 |
| InChIKey | GEOITKSPYQTFKA-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethylbenzene;1-ethyl-3-ethynylbenzene;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylbenzene;1-ethyl-3-ethynylbenzene;propane?
The IUPAC name of ethylbenzene;1-ethyl-3-ethynylbenzene;propane (CID 171552337) is ethylbenzene;1-ethyl-3-ethynylbenzene;propane.
What is the SMILES notation for ethylbenzene;1-ethyl-3-ethynylbenzene;propane?
The canonical SMILES for ethylbenzene;1-ethyl-3-ethynylbenzene;propane is C#Cc1cccc(CC)c1.CCC.CCc1ccccc1.
What is the InChIKey of ethylbenzene;1-ethyl-3-ethynylbenzene;propane?
The InChIKey is GEOITKSPYQTFKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10.C8H10.C3H8/c1-3-9-6-5-7-10(4-2)8-9;1-2-8-6-4-3-5-7-8;1-3-2/h1,5-8H,4H2,2H3;3-7H,2H2,1H3;3H2,1-2H3.
What are the key properties of ethylbenzene;1-ethyl-3-ethynylbenzene;propane?
ethylbenzene;1-ethyl-3-ethynylbenzene;propane has a molecular weight of 280.45 g/mol, XLogP of 5.90, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethylbenzene;1-ethyl-3-ethynylbenzene;propane is sourced from PubChem (CID 171552337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).