C11H13ClO — CID 130756421
[(1R,2S)-2-chloro-1-ethoxycyclopropyl]benzene (PubChem CID 130756421) has the molecular formula C11H13ClO and a molecular weight of 196.68 g/mol. Its IUPAC name is [(1R,2S)-2-chloro-1-ethoxycyclopropyl]benzene.
| Compound Name | [(1R,2S)-2-chloro-1-ethoxycyclopropyl]benzene |
|---|---|
| PubChem CID | 130756421 |
| Molecular Formula | C11H13ClO |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | [(1R,2S)-2-chloro-1-ethoxycyclopropyl]benzene |
| SMILES | CCO[C@@]1(c2ccccc2)C[C@@H]1Cl |
| InChI | InChI=1S/C11H13ClO/c1-2-13-11(8-10(11)12)9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3/t10-,11+/m0/s1 |
| InChIKey | SJAIVWHGTVSDQB-WDEREUQCSA-N |
| XLogP | 2.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|