C19H19BrN2O2 — CID 7628451
trans-(1R,2R)-N-[(E)-(2-bromophenyl)methylideneamino]-2-ethoxy-2-phenylcyclopropane-1-carboxamide (PubChem CID 7628451) has the molecular formula C19H19BrN2O2 and a molecular weight of 387.28 g/mol. Its IUPAC name is trans-(1R,2R)-N-[(E)-(2-bromophenyl)methylideneamino]-2-ethoxy-2-phenylcyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-[(E)-(2-bromophenyl)methylideneamino]-2-ethoxy-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 7628451 |
| Molecular Formula | C19H19BrN2O2 |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | trans-(1R,2R)-N-[(E)-(2-bromophenyl)methylideneamino]-2-ethoxy-2-phenylcyclopropane-1-carboxamide |
| SMILES | CCO[C@]1(c2ccccc2)C[C@H]1C(=O)N/N=C/c1ccccc1Br |
| InChI | InChI=1S/C19H19BrN2O2/c1-2-24-19(15-9-4-3-5-10-15)12-16(19)18(23)22-21-13-14-8-6-7-11-17(14)20/h3-11,13,16H,2,12H2,1H3,(H,22,23)/b21-13+/t16-,19-/m0/s1 |
| InChIKey | DBJYWEVDTLBXME-DBLWUSGISA-N |
| XLogP | 3.85 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|