C19H19N3O4 — CID 7241718
trans-(1S,2S)-2-ethoxy-N-[(Z)-(4-nitrophenyl)methylideneamino]-2-phenylcyclopropane-1-carboxamide (PubChem CID 7241718) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is trans-(1S,2S)-2-ethoxy-N-[(Z)-(4-nitrophenyl)methylideneamino]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-2-ethoxy-N-[(Z)-(4-nitrophenyl)methylideneamino]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 7241718 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | trans-(1S,2S)-2-ethoxy-N-[(Z)-(4-nitrophenyl)methylideneamino]-2-phenylcyclopropane-1-carboxamide |
| SMILES | CCO[C@@]1(c2ccccc2)C[C@@H]1C(=O)N/N=C\c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H19N3O4/c1-2-26-19(15-6-4-3-5-7-15)12-17(19)18(23)21-20-13-14-8-10-16(11-9-14)22(24)25/h3-11,13,17H,2,12H2,1H3,(H,21,23)/b20-13-/t17-,19-/m1/s1 |
| InChIKey | BDLZUEYACMLUIQ-LJBWOGQWSA-N |
| XLogP | 3.00 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|