C21H25BrN2O — CID 3959146
N-[(2-bromophenyl)methylideneamino]bicyclo[10.1.0]trideca-4,8-diene-13-carboxamide (PubChem CID 3959146) has the molecular formula C21H25BrN2O and a molecular weight of 401.35 g/mol. Its IUPAC name is N-[(2-bromophenyl)methylideneamino]bicyclo[10.1.0]trideca-4,8-diene-13-carboxamide.
| Compound Name | N-[(2-bromophenyl)methylideneamino]bicyclo[10.1.0]trideca-4,8-diene-13-carboxamide |
|---|---|
| PubChem CID | 3959146 |
| Molecular Formula | C21H25BrN2O |
| Molecular Weight | 401.35 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | N-[(2-bromophenyl)methylideneamino]bicyclo[10.1.0]trideca-4,8-diene-13-carboxamide |
| SMILES | O=C(NN=Cc1ccccc1Br)C1C2CCC=CCCC=CCCC21 |
| InChI | InChI=1S/C21H25BrN2O/c22-19-14-10-9-11-16(19)15-23-24-21(25)20-17-12-7-5-3-1-2-4-6-8-13-18(17)20/h3-6,9-11,14-15,17-18,20H,1-2,7-8,12-13H2,(H,24,25) |
| InChIKey | CXSVWIBMCMBREG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.35 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|