C17H19BrN2O — CID 7348527
(1S,4Z,8S)-N-[(Z)-(4-bromophenyl)methylideneamino]bicyclo[6.1.0]non-4-ene-9-carboxamide (PubChem CID 7348527) has the molecular formula C17H19BrN2O and a molecular weight of 347.26 g/mol. Its IUPAC name is (1S,4Z,8S)-N-[(Z)-(4-bromophenyl)methylideneamino]bicyclo[6.1.0]non-4-ene-9-carboxamide.
| Compound Name | (1S,4Z,8S)-N-[(Z)-(4-bromophenyl)methylideneamino]bicyclo[6.1.0]non-4-ene-9-carboxamide |
|---|---|
| PubChem CID | 7348527 |
| Molecular Formula | C17H19BrN2O |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | (1S,4Z,8S)-N-[(Z)-(4-bromophenyl)methylideneamino]bicyclo[6.1.0]non-4-ene-9-carboxamide |
| SMILES | O=C(N/N=C\c1ccc(Br)cc1)C1[C@H]2CC/C=C\CC[C@H]12 |
| InChI | InChI=1S/C17H19BrN2O/c18-13-9-7-12(8-10-13)11-19-20-17(21)16-14-5-3-1-2-4-6-15(14)16/h1-2,7-11,14-16H,3-6H2,(H,20,21)/b2-1-,19-11-/t14-,15-/m0/s1 |
| InChIKey | YRDYROPTOFWUKW-VRKTUPMQSA-N |
| XLogP | 3.89 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|