C14H18Cl2O2 — CID 14924955
[2,2-dichloro-1-(diethoxymethyl)cyclopropyl]benzene (PubChem CID 14924955) has the molecular formula C14H18Cl2O2 and a molecular weight of 289.20 g/mol. Its IUPAC name is [2,2-dichloro-1-(diethoxymethyl)cyclopropyl]benzene.
| Compound Name | [2,2-dichloro-1-(diethoxymethyl)cyclopropyl]benzene |
|---|---|
| PubChem CID | 14924955 |
| Molecular Formula | C14H18Cl2O2 |
| Molecular Weight | 289.20 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | [2,2-dichloro-1-(diethoxymethyl)cyclopropyl]benzene |
| SMILES | CCOC(OCC)C1(c2ccccc2)CC1(Cl)Cl |
| InChI | InChI=1S/C14H18Cl2O2/c1-3-17-12(18-4-2)13(10-14(13,15)16)11-8-6-5-7-9-11/h5-9,12H,3-4,10H2,1-2H3 |
| InChIKey | QJCQEZNXTYGXLG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.20 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|