C17H16Cl2O2 — CID 10336292
3,3-dichloro-5-methyl-2,5-diphenyloxolan-2-ol (PubChem CID 10336292) has the molecular formula C17H16Cl2O2 and a molecular weight of 323.22 g/mol. Its IUPAC name is 3,3-dichloro-5-methyl-2,5-diphenyloxolan-2-ol.
| Compound Name | 3,3-dichloro-5-methyl-2,5-diphenyloxolan-2-ol |
|---|---|
| PubChem CID | 10336292 |
| Molecular Formula | C17H16Cl2O2 |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 3,3-dichloro-5-methyl-2,5-diphenyloxolan-2-ol |
| SMILES | CC1(c2ccccc2)CC(Cl)(Cl)C(O)(c2ccccc2)O1 |
| InChI | InChI=1S/C17H16Cl2O2/c1-15(13-8-4-2-5-9-13)12-16(18,19)17(20,21-15)14-10-6-3-7-11-14/h2-11,20H,12H2,1H3 |
| InChIKey | YCOPHOBXAFFGQG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|