C21H24OSe2 — CID 14959257
2,2,4,4-tetramethyl-1,5-diphenyl-8-oxa-6,7-diselenabicyclo[3.2.1]octane (PubChem CID 14959257) has the molecular formula C21H24OSe2 and a molecular weight of 450.34 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-1,5-diphenyl-8-oxa-6,7-diselenabicyclo[3.2.1]octane.
| Compound Name | 2,2,4,4-tetramethyl-1,5-diphenyl-8-oxa-6,7-diselenabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 14959257 |
| Molecular Formula | C21H24OSe2 |
| Molecular Weight | 450.34 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | 2,2,4,4-tetramethyl-1,5-diphenyl-8-oxa-6,7-diselenabicyclo[3.2.1]octane |
| SMILES | CC1(C)CC(C)(C)C2(c3ccccc3)OC1(c1ccccc1)[Se][Se]2 |
| InChI | InChI=1S/C21H24OSe2/c1-18(2)15-19(3,4)21(17-13-9-6-10-14-17)22-20(18,23-24-21)16-11-7-5-8-12-16/h5-14H,15H2,1-4H3 |
| InChIKey | IJOUVPQTGOWDRD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.34 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|