C17H14O2 — CID 11831839
(1S,4R)-1,4-diphenyl-2,3-dioxabicyclo[2.2.1]hept-5-ene (PubChem CID 11831839) has the molecular formula C17H14O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is (1S,4R)-1,4-diphenyl-2,3-dioxabicyclo[2.2.1]hept-5-ene.
| Compound Name | (1S,4R)-1,4-diphenyl-2,3-dioxabicyclo[2.2.1]hept-5-ene |
|---|---|
| PubChem CID | 11831839 |
| Molecular Formula | C17H14O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (1S,4R)-1,4-diphenyl-2,3-dioxabicyclo[2.2.1]hept-5-ene |
| SMILES | C1=C[C@@]2(c3ccccc3)C[C@]1(c1ccccc1)OO2 |
| InChI | InChI=1S/C17H14O2/c1-3-7-14(8-4-1)16-11-12-17(13-16,19-18-16)15-9-5-2-6-10-15/h1-12H,13H2/t16-,17+ |
| InChIKey | SCYNUJRIRVJAQV-CALCHBBNSA-N |
| XLogP | 3.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|