C9H7Cl3 — CID 95239829
[(1S)-1,2,2-trichlorocyclopropyl]benzene (PubChem CID 95239829) has the molecular formula C9H7Cl3 and a molecular weight of 221.51 g/mol. Its IUPAC name is [(1S)-1,2,2-trichlorocyclopropyl]benzene.
| Compound Name | [(1S)-1,2,2-trichlorocyclopropyl]benzene |
|---|---|
| PubChem CID | 95239829 |
| Molecular Formula | C9H7Cl3 |
| Molecular Weight | 221.51 g/mol |
| Exact Mass | 219.96 |
| IUPAC Name | [(1S)-1,2,2-trichlorocyclopropyl]benzene |
| SMILES | ClC1(Cl)C[C@]1(Cl)c1ccccc1 |
| InChI | InChI=1S/C9H7Cl3/c10-8(6-9(8,11)12)7-4-2-1-3-5-7/h1-5H,6H2/t8-/m0/s1 |
| InChIKey | ONAJYBXETTZZQP-QMMMGPOBSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|