C12H11Cl3 — CID 172813377
(1,5,5-trichlorocyclohex-3-en-1-yl)benzene (PubChem CID 172813377) has the molecular formula C12H11Cl3 and a molecular weight of 261.58 g/mol. Its IUPAC name is (1,5,5-trichlorocyclohex-3-en-1-yl)benzene.
| Compound Name | (1,5,5-trichlorocyclohex-3-en-1-yl)benzene |
|---|---|
| PubChem CID | 172813377 |
| Molecular Formula | C12H11Cl3 |
| Molecular Weight | 261.58 g/mol |
| Exact Mass | 259.99 |
| IUPAC Name | (1,5,5-trichlorocyclohex-3-en-1-yl)benzene |
| SMILES | ClC1(Cl)C=CCC(Cl)(c2ccccc2)C1 |
| InChI | InChI=1S/C12H11Cl3/c13-11(10-5-2-1-3-6-10)7-4-8-12(14,15)9-11/h1-6,8H,7,9H2 |
| InChIKey | SMIPWPOONQOMLX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.58 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|