C14H15Cl3O — CID 172686764
[1,5-dichloro-5-(chloromethyl)cyclohex-3-en-1-yl]oxymethylbenzene (PubChem CID 172686764) has the molecular formula C14H15Cl3O and a molecular weight of 305.63 g/mol. Its IUPAC name is [1,5-dichloro-5-(chloromethyl)cyclohex-3-en-1-yl]oxymethylbenzene.
| Compound Name | [1,5-dichloro-5-(chloromethyl)cyclohex-3-en-1-yl]oxymethylbenzene |
|---|---|
| PubChem CID | 172686764 |
| Molecular Formula | C14H15Cl3O |
| Molecular Weight | 305.63 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | [1,5-dichloro-5-(chloromethyl)cyclohex-3-en-1-yl]oxymethylbenzene |
| SMILES | ClCC1(Cl)C=CCC(Cl)(OCc2ccccc2)C1 |
| InChI | InChI=1S/C14H15Cl3O/c15-11-13(16)7-4-8-14(17,10-13)18-9-12-5-2-1-3-6-12/h1-7H,8-11H2 |
| InChIKey | BDGMZJUKOUWIDG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.63 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|