C12H14Cl2N2 — CID 141139703
5,5-dichloro-1-phenylcyclohex-2-ene-1,4-diamine (PubChem CID 141139703) has the molecular formula C12H14Cl2N2 and a molecular weight of 257.16 g/mol. Its IUPAC name is 5,5-dichloro-1-phenylcyclohex-2-ene-1,4-diamine.
| Compound Name | 5,5-dichloro-1-phenylcyclohex-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 141139703 |
| Molecular Formula | C12H14Cl2N2 |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 5,5-dichloro-1-phenylcyclohex-2-ene-1,4-diamine |
| SMILES | NC1C=CC(N)(c2ccccc2)CC1(Cl)Cl |
| InChI | InChI=1S/C12H14Cl2N2/c13-12(14)8-11(16,7-6-10(12)15)9-4-2-1-3-5-9/h1-7,10H,8,15-16H2 |
| InChIKey | GBYGZWHPSDXDNL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|