C15H19NO — CID 172683358
3-[(1R)-6-amino-1-phenylcyclohexa-2,4-dien-1-yl]propan-1-ol (PubChem CID 172683358) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is 3-[(1R)-6-amino-1-phenylcyclohexa-2,4-dien-1-yl]propan-1-ol.
| Compound Name | 3-[(1R)-6-amino-1-phenylcyclohexa-2,4-dien-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 172683358 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 3-[(1R)-6-amino-1-phenylcyclohexa-2,4-dien-1-yl]propan-1-ol |
| SMILES | NC1C=CC=C[C@]1(CCCO)c1ccccc1 |
| InChI | InChI=1S/C15H19NO/c16-14-9-4-5-10-15(14,11-6-12-17)13-7-2-1-3-8-13/h1-5,7-10,14,17H,6,11-12,16H2/t14?,15-/m0/s1 |
| InChIKey | ARXXLTAERQJMMP-LOACHALJSA-N |
| XLogP | 2.15 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |