C18H15Br — CID 159538084
5-bromo-5,6-diphenylcyclohexa-1,3-diene (PubChem CID 159538084) has the molecular formula C18H15Br and a molecular weight of 311.22 g/mol. Its IUPAC name is 5-bromo-5,6-diphenylcyclohexa-1,3-diene.
| Compound Name | 5-bromo-5,6-diphenylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 159538084 |
| Molecular Formula | C18H15Br |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 5-bromo-5,6-diphenylcyclohexa-1,3-diene |
| SMILES | BrC1(c2ccccc2)C=CC=CC1c1ccccc1 |
| InChI | InChI=1S/C18H15Br/c19-18(16-11-5-2-6-12-16)14-8-7-13-17(18)15-9-3-1-4-10-15/h1-14,17H |
| InChIKey | MDVTXYXIXOCLMY-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|