C26H18N2O2 — CID 141318191
[4-[1-(4-cyanatophenyl)-6-phenylcyclohexa-2,4-dien-1-yl]phenyl] cyanate (PubChem CID 141318191) has the molecular formula C26H18N2O2 and a molecular weight of 390.44 g/mol. Its IUPAC name is [4-[1-(4-cyanatophenyl)-6-phenylcyclohexa-2,4-dien-1-yl]phenyl] cyanate.
| Compound Name | [4-[1-(4-cyanatophenyl)-6-phenylcyclohexa-2,4-dien-1-yl]phenyl] cyanate |
|---|---|
| PubChem CID | 141318191 |
| Molecular Formula | C26H18N2O2 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | [4-[1-(4-cyanatophenyl)-6-phenylcyclohexa-2,4-dien-1-yl]phenyl] cyanate |
| SMILES | N#COc1ccc(C2(c3ccc(OC#N)cc3)C=CC=CC2c2ccccc2)cc1 |
| InChI | InChI=1S/C26H18N2O2/c27-18-29-23-13-9-21(10-14-23)26(22-11-15-24(16-12-22)30-19-28)17-5-4-8-25(26)20-6-2-1-3-7-20/h1-17,25H |
| InChIKey | JSJLSDUTTBDEEI-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|