About (4-cyclododecylphenyl) cyanate
(4-cyclododecylphenyl) cyanate (PubChem CID 142705601) has the molecular formula C19H27NO
and a molecular weight of 285.43 g/mol. Its IUPAC name is (4-cyclododecylphenyl) cyanate.
Molecular Properties
| Compound Name | (4-cyclododecylphenyl) cyanate |
| PubChem CID | 142705601 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | (4-cyclododecylphenyl) cyanate |
| SMILES | N#COc1ccc(C2CCCCCCCCCCC2)cc1 |
| InChI | InChI=1S/C19H27NO/c20-16-21-19-14-12-18(13-15-19)17-10-8-6-4-2-1-3-5-7-9-11-17/h12-15,17H,1-11H2 |
| InChIKey | YSVOFUDITYTTTN-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze (4-cyclododecylphenyl) cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyclododecylphenyl) cyanate?
The IUPAC name of (4-cyclododecylphenyl) cyanate (CID 142705601) is (4-cyclododecylphenyl) cyanate.
What is the SMILES notation for (4-cyclododecylphenyl) cyanate?
The canonical SMILES for (4-cyclododecylphenyl) cyanate is N#COc1ccc(C2CCCCCCCCCCC2)cc1.
What is the InChIKey of (4-cyclododecylphenyl) cyanate?
The InChIKey is YSVOFUDITYTTTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27NO/c20-16-21-19-14-12-18(13-15-19)17-10-8-6-4-2-1-3-5-7-9-11-17/h12-15,17H,1-11H2.
What are the key properties of (4-cyclododecylphenyl) cyanate?
(4-cyclododecylphenyl) cyanate has a molecular weight of 285.43 g/mol, XLogP of 5.93, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyclododecylphenyl) cyanate is sourced from PubChem (CID 142705601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).