About acetonitrile;cyclohexylbenzene
acetonitrile;cyclohexylbenzene (PubChem CID 141289539) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is acetonitrile;cyclohexylbenzene.
Molecular Properties
| Compound Name | acetonitrile;cyclohexylbenzene |
| PubChem CID | 141289539 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | acetonitrile;cyclohexylbenzene |
| SMILES | CC#N.c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C12H16.C2H3N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-3/h1,3-4,7-8,12H,2,5-6,9-10H2;1H3 |
| InChIKey | AKRASBZCOZTZIF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze acetonitrile;cyclohexylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;cyclohexylbenzene?
The IUPAC name of acetonitrile;cyclohexylbenzene (CID 141289539) is acetonitrile;cyclohexylbenzene.
What is the SMILES notation for acetonitrile;cyclohexylbenzene?
The canonical SMILES for acetonitrile;cyclohexylbenzene is CC#N.c1ccc(C2CCCCC2)cc1.
What is the InChIKey of acetonitrile;cyclohexylbenzene?
The InChIKey is AKRASBZCOZTZIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16.C2H3N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-3/h1,3-4,7-8,12H,2,5-6,9-10H2;1H3.
What are the key properties of acetonitrile;cyclohexylbenzene?
acetonitrile;cyclohexylbenzene has a molecular weight of 201.31 g/mol, XLogP of 4.26, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;cyclohexylbenzene is sourced from PubChem (CID 141289539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).